C30H38N2O9 — CID 58648131
(4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-9-(2-methyl-5-morpholin-4-ylpentan-2-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58648131) has the molecular formula C30H38N2O9 and a molecular weight of 570.64 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-9-(2-methyl-5-morpholin-4-ylpentan-2-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-9-(2-methyl-5-morpholin-4-ylpentan-2-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58648131 |
| Molecular Formula | C30H38N2O9 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | (4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-9-(2-methyl-5-morpholin-4-ylpentan-2-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(C(C)(C)CCCN3CCOCC3)c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C30H38N2O9/c1-14-15-5-6-16(29(2,3)7-4-8-32-9-11-41-12-10-32)23(34)20(15)25(36)22-19(14)24(35)17-13-18(33)21(28(31)39)26(37)30(17,40)27(22)38/h5-6,14,17,19,24,34-37,40H,4,7-13H2,1-3H3,(H2,31,39)/t14-,17+,19+,24+,30+/m0/s1 |
| InChIKey | JPPQKAGOUOLSNJ-YMURORLGSA-N |
| XLogP | 1.35 |
| TPSA | 190.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|