C26H22FNO8 — CID 58648219
(4aR,5S,5aR,6R,12aR)-7-(4-fluorophenyl)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58648219) has the molecular formula C26H22FNO8 and a molecular weight of 495.46 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aR)-7-(4-fluorophenyl)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aR)-7-(4-fluorophenyl)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58648219 |
| Molecular Formula | C26H22FNO8 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (4aR,5S,5aR,6R,12aR)-7-(4-fluorophenyl)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@H]1c2c(-c3ccc(F)cc3)ccc(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C26H22FNO8/c1-9-16-12(10-2-4-11(27)5-3-10)6-7-14(29)18(16)22(32)20-17(9)21(31)13-8-15(30)19(25(28)35)23(33)26(13,36)24(20)34/h2-7,9,13,17,21,29,31-33,36H,8H2,1H3,(H2,28,35)/t9-,13+,17+,21+,26+/m0/s1 |
| InChIKey | UUEVNJCDVCJIGX-XZIZSAADSA-N |
| XLogP | 1.76 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|