C27H20F3NO8 — CID 58648401
(4aR,5S,5aR,6Z,12aR)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[[4-(trifluoromethyl)phenyl]methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 58648401) has the molecular formula C27H20F3NO8 and a molecular weight of 543.45 g/mol. Its IUPAC name is (4aR,5S,5aR,6Z,12aR)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[[4-(trifluoromethyl)phenyl]methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6Z,12aR)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[[4-(trifluoromethyl)phenyl]methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 58648401 |
| Molecular Formula | C27H20F3NO8 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | (4aR,5S,5aR,6Z,12aR)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[[4-(trifluoromethyl)phenyl]methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4/C(=C\c4ccc(C(F)(F)F)cc4)[C@H]3[C@H](O)[C@H]2CC1=O |
| InChI | InChI=1S/C27H20F3NO8/c28-27(29,30)11-6-4-10(5-7-11)8-13-12-2-1-3-15(32)17(12)22(35)20-18(13)21(34)14-9-16(33)19(25(31)38)23(36)26(14,39)24(20)37/h1-8,14,18,21,32,34-36,39H,9H2,(H2,31,38)/b13-8+/t14-,18-,21-,26-/m1/s1 |
| InChIKey | WXPBZUHLNPWMHZ-JSZSFQLWSA-N |
| XLogP | 2.41 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|