About [(1R,5S)-4-acetyloxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl] acetate
[(1R,5S)-4-acetyloxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl] acetate (PubChem CID 58648764) has the molecular formula C13H18O4
and a molecular weight of 238.28 g/mol. Its IUPAC name is [(1R,5S)-4-acetyloxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl] acetate.
Molecular Properties
| Compound Name | [(1R,5S)-4-acetyloxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl] acetate |
| PubChem CID | 58648764 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | [(1R,5S)-4-acetyloxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl] acetate |
| SMILES | CC(=O)OC1=CC(OC(C)=O)[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C13H18O4/c1-7(14)16-11-6-12(17-8(2)15)10-5-9(11)13(10,3)4/h6,9-11H,5H2,1-4H3/t9-,10+,11?/m0/s1 |
| InChIKey | YFJDGZZRPOYOFP-MTULOOOASA-N |
| XLogP | 2.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R,5S)-4-acetyloxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5S)-4-acetyloxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl] acetate?
The IUPAC name of [(1R,5S)-4-acetyloxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl] acetate (CID 58648764) is [(1R,5S)-4-acetyloxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl] acetate.
What is the SMILES notation for [(1R,5S)-4-acetyloxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl] acetate?
The canonical SMILES for [(1R,5S)-4-acetyloxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl] acetate is CC(=O)OC1=CC(OC(C)=O)[C@@H]2C[C@H]1C2(C)C.
What is the InChIKey of [(1R,5S)-4-acetyloxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl] acetate?
The InChIKey is YFJDGZZRPOYOFP-MTULOOOASA-N. The full InChI is InChI=1S/C13H18O4/c1-7(14)16-11-6-12(17-8(2)15)10-5-9(11)13(10,3)4/h6,9-11H,5H2,1-4H3/t9-,10+,11?/m0/s1.
What are the key properties of [(1R,5S)-4-acetyloxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl] acetate?
[(1R,5S)-4-acetyloxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl] acetate has a molecular weight of 238.28 g/mol, XLogP of 2.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5S)-4-acetyloxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl] acetate is sourced from PubChem (CID 58648764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).