C17H31ClN2O3 — CID 58650552
ethyl (E,4S)-4-[[(2S)-2-(chloroamino)-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate (PubChem CID 58650552) has the molecular formula C17H31ClN2O3 and a molecular weight of 346.90 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(2S)-2-(chloroamino)-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(2S)-2-(chloroamino)-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 58650552 |
| Molecular Formula | C17H31ClN2O3 |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | ethyl (E,4S)-4-[[(2S)-2-(chloroamino)-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)[C@@H](NCl)C(C)(C)C |
| InChI | InChI=1S/C17H31ClN2O3/c1-9-23-16(22)12(4)10-13(11(2)3)20(8)15(21)14(19-18)17(5,6)7/h10-11,13-14,19H,9H2,1-8H3/b12-10+/t13-,14-/m1/s1 |
| InChIKey | ZDVIZPQTHFGYCL-XMNZZIDVSA-N |
| XLogP | 3.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|