C9H15ClO2 — CID 58650784
(2S,3R,4S,5R)-2-(chloromethyl)-3,5-dimethyl-6-methylideneoxan-4-ol (PubChem CID 58650784) has the molecular formula C9H15ClO2 and a molecular weight of 190.67 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(chloromethyl)-3,5-dimethyl-6-methylideneoxan-4-ol.
| Compound Name | (2S,3R,4S,5R)-2-(chloromethyl)-3,5-dimethyl-6-methylideneoxan-4-ol |
|---|---|
| PubChem CID | 58650784 |
| Molecular Formula | C9H15ClO2 |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (2S,3R,4S,5R)-2-(chloromethyl)-3,5-dimethyl-6-methylideneoxan-4-ol |
| SMILES | C=C1O[C@H](CCl)[C@H](C)[C@H](O)[C@H]1C |
| InChI | InChI=1S/C9H15ClO2/c1-5-7(3)12-8(4-10)6(2)9(5)11/h5-6,8-9,11H,3-4H2,1-2H3/t5-,6-,8+,9+/m0/s1 |
| InChIKey | LNKLQXKJOLEQPY-HMJBSVBGSA-N |
| XLogP | 1.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|