C14H18N6O2S2 — CID 58651839
N-[1-methyl-7-(1,3,4-thiadiazol-2-yldiazenyl)-2,3,4,5-tetrahydro-1-benzazepin-8-yl]methanesulfonamide (PubChem CID 58651839) has the molecular formula C14H18N6O2S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[1-methyl-7-(1,3,4-thiadiazol-2-yldiazenyl)-2,3,4,5-tetrahydro-1-benzazepin-8-yl]methanesulfonamide.
| Compound Name | N-[1-methyl-7-(1,3,4-thiadiazol-2-yldiazenyl)-2,3,4,5-tetrahydro-1-benzazepin-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 58651839 |
| Molecular Formula | C14H18N6O2S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-[1-methyl-7-(1,3,4-thiadiazol-2-yldiazenyl)-2,3,4,5-tetrahydro-1-benzazepin-8-yl]methanesulfonamide |
| SMILES | CN1CCCCc2cc(/N=N/c3nncs3)c(NS(C)(=O)=O)cc21 |
| InChI | InChI=1S/C14H18N6O2S2/c1-20-6-4-3-5-10-7-11(16-18-14-17-15-9-23-14)12(8-13(10)20)19-24(2,21)22/h7-9,19H,3-6H2,1-2H3/b18-16+ |
| InChIKey | JICAXWWFQKETRC-FBMGVBCBSA-N |
| XLogP | 3.10 |
| TPSA | 99.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|