C24H27NO2 — CID 58651861
pentyl (Z)-3-[4-[(4-prop-1-en-2-ylphenyl)methylideneamino]phenyl]prop-2-enoate (PubChem CID 58651861) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is pentyl (Z)-3-[4-[(4-prop-1-en-2-ylphenyl)methylideneamino]phenyl]prop-2-enoate.
| Compound Name | pentyl (Z)-3-[4-[(4-prop-1-en-2-ylphenyl)methylideneamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58651861 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | pentyl (Z)-3-[4-[(4-prop-1-en-2-ylphenyl)methylideneamino]phenyl]prop-2-enoate |
| SMILES | C=C(C)c1ccc(/C=N/c2ccc(/C=C\C(=O)OCCCCC)cc2)cc1 |
| InChI | InChI=1S/C24H27NO2/c1-4-5-6-17-27-24(26)16-11-20-9-14-23(15-10-20)25-18-21-7-12-22(13-8-21)19(2)3/h7-16,18H,2,4-6,17H2,1,3H3/b16-11-,25-18+ |
| InChIKey | GQMHFWLEVOBPRC-JEFSIKNESA-N |
| XLogP | 6.22 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|