C36H46 — CID 58652261
3,4,4,5,6,6,8,9,10,11,11,12-dodecamethyl-7,9-diphenylhexacyclo[6.4.0.01,10.02,5.02,7.03,12]dodecane (PubChem CID 58652261) has the molecular formula C36H46 and a molecular weight of 478.76 g/mol. Its IUPAC name is 3,4,4,5,6,6,8,9,10,11,11,12-dodecamethyl-7,9-diphenylhexacyclo[6.4.0.01,10.02,5.02,7.03,12]dodecane.
| Compound Name | 3,4,4,5,6,6,8,9,10,11,11,12-dodecamethyl-7,9-diphenylhexacyclo[6.4.0.01,10.02,5.02,7.03,12]dodecane |
|---|---|
| PubChem CID | 58652261 |
| Molecular Formula | C36H46 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.36 |
| IUPAC Name | 3,4,4,5,6,6,8,9,10,11,11,12-dodecamethyl-7,9-diphenylhexacyclo[6.4.0.01,10.02,5.02,7.03,12]dodecane |
| SMILES | CC1(C)C2(C)C(C)(c3ccccc3)C3(C)C4(c5ccccc5)C(C)(C)C5(C)C(C)(C)C6(C)C1(C)C23C564 |
| InChI | InChI=1S/C36H46/c1-25(2)29(8)27(5,6)34(24-21-17-14-18-22-24)33(12)28(7,23-19-15-13-16-20-23)30(9)26(3,4)31(10)32(25,11)36(29,34)35(30,31)33/h13-22H,1-12H3 |
| InChIKey | TXJACYUKFNPOQY-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |