About 3,9-dihydroxybenzo[b][1,4]benzodioxepin-6-one
3,9-dihydroxybenzo[b][1,4]benzodioxepin-6-one (PubChem CID 58652990) has the molecular formula C13H8O5
and a molecular weight of 244.20 g/mol. Its IUPAC name is 3,9-dihydroxybenzo[b][1,4]benzodioxepin-6-one.
Molecular Properties
| Compound Name | 3,9-dihydroxybenzo[b][1,4]benzodioxepin-6-one |
| PubChem CID | 58652990 |
| Molecular Formula | C13H8O5 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 3,9-dihydroxybenzo[b][1,4]benzodioxepin-6-one |
| SMILES | O=C1Oc2cc(O)ccc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C13H8O5/c14-7-1-3-9-11(5-7)17-10-4-2-8(15)6-12(10)18-13(9)16/h1-6,14-15H |
| InChIKey | HKRBIJPAPPLWGG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3,9-dihydroxybenzo[b][1,4]benzodioxepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,9-dihydroxybenzo[b][1,4]benzodioxepin-6-one?
The IUPAC name of 3,9-dihydroxybenzo[b][1,4]benzodioxepin-6-one (CID 58652990) is 3,9-dihydroxybenzo[b][1,4]benzodioxepin-6-one.
What is the SMILES notation for 3,9-dihydroxybenzo[b][1,4]benzodioxepin-6-one?
The canonical SMILES for 3,9-dihydroxybenzo[b][1,4]benzodioxepin-6-one is O=C1Oc2cc(O)ccc2Oc2cc(O)ccc21.
What is the InChIKey of 3,9-dihydroxybenzo[b][1,4]benzodioxepin-6-one?
The InChIKey is HKRBIJPAPPLWGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O5/c14-7-1-3-9-11(5-7)17-10-4-2-8(15)6-12(10)18-13(9)16/h1-6,14-15H.
What are the key properties of 3,9-dihydroxybenzo[b][1,4]benzodioxepin-6-one?
3,9-dihydroxybenzo[b][1,4]benzodioxepin-6-one has a molecular weight of 244.20 g/mol, XLogP of 2.42, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,9-dihydroxybenzo[b][1,4]benzodioxepin-6-one is sourced from PubChem (CID 58652990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).