C23H30F3N3O4 — CID 58653373
methyl N-[4-[(5R)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-3-(trifluoromethyl)phenyl]carbamate (PubChem CID 58653373) has the molecular formula C23H30F3N3O4 and a molecular weight of 469.50 g/mol. Its IUPAC name is methyl N-[4-[(5R)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | methyl N-[4-[(5R)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 58653373 |
| Molecular Formula | C23H30F3N3O4 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | methyl N-[4-[(5R)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-3-(trifluoromethyl)phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(N2CCC[C@@]3(CCN(C4CCC(O)CC4)C3=O)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H30F3N3O4/c1-33-21(32)27-15-3-8-19(18(13-15)23(24,25)26)28-11-2-9-22(14-28)10-12-29(20(22)31)16-4-6-17(30)7-5-16/h3,8,13,16-17,30H,2,4-7,9-12,14H2,1H3,(H,27,32)/t16?,17?,22-/m1/s1 |
| InChIKey | SFYZVENUSFXRCI-CNXQINBVSA-N |
| XLogP | 4.01 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|