About 9-cyclohexyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one
9-cyclohexyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 58653469) has the molecular formula C15H26N2O
and a molecular weight of 250.39 g/mol. Its IUPAC name is 9-cyclohexyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one.
Molecular Properties
| Compound Name | 9-cyclohexyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one |
| PubChem CID | 58653469 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 9-cyclohexyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | CN1CCC2(CCCN(C3CCCCC3)C2)C1=O |
| InChI | InChI=1S/C15H26N2O/c1-16-11-9-15(14(16)18)8-5-10-17(12-15)13-6-3-2-4-7-13/h13H,2-12H2,1H3 |
| InChIKey | UBCCEKYBFDBLAP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-cyclohexyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-cyclohexyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one?
The IUPAC name of 9-cyclohexyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one (CID 58653469) is 9-cyclohexyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one.
What is the SMILES notation for 9-cyclohexyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one?
The canonical SMILES for 9-cyclohexyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one is CN1CCC2(CCCN(C3CCCCC3)C2)C1=O.
What is the InChIKey of 9-cyclohexyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one?
The InChIKey is UBCCEKYBFDBLAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O/c1-16-11-9-15(14(16)18)8-5-10-17(12-15)13-6-3-2-4-7-13/h13H,2-12H2,1H3.
What are the key properties of 9-cyclohexyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one?
9-cyclohexyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one has a molecular weight of 250.39 g/mol, XLogP of 2.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-cyclohexyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one is sourced from PubChem (CID 58653469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).