About methyl 2-[2-[4-[4-(triazol-1-yl)butyl]phenyl]ethylamino]acetate;tungsten;vanadium
methyl 2-[2-[4-[4-(triazol-1-yl)butyl]phenyl]ethylamino]acetate;tungsten;vanadium (PubChem CID 58653843) has the molecular formula C17H22N4O2VW-2
and a molecular weight of 549.17 g/mol. Its IUPAC name is methyl 2-[2-[4-[4-(triazol-1-yl)butyl]phenyl]ethylamino]acetate;tungsten;vanadium.
Molecular Properties
| Compound Name | methyl 2-[2-[4-[4-(triazol-1-yl)butyl]phenyl]ethylamino]acetate;tungsten;vanadium |
| PubChem CID | 58653843 |
| Molecular Formula | C17H22N4O2VW-2 |
| Molecular Weight | 549.17 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | methyl 2-[2-[4-[4-(triazol-1-yl)butyl]phenyl]ethylamino]acetate;tungsten;vanadium |
| SMILES | COC(=O)[CH-]N[CH-]Cc1ccc(CCCCn2ccnn2)cc1.[V].[W] |
| InChI | InChI=1S/C17H22N4O2.V.W/c1-23-17(22)14-18-10-9-16-7-5-15(6-8-16)4-2-3-12-21-13-11-19-20-21;;/h5-8,10-11,13-14,18H,2-4,9,12H2,1H3;;/q-2;; |
| InChIKey | HHOLHEHTZGZPDS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 549.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[2-[4-[4-(triazol-1-yl)butyl]phenyl]ethylamino]acetate;tungsten;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-[4-[4-(triazol-1-yl)butyl]phenyl]ethylamino]acetate;tungsten;vanadium?
The IUPAC name of methyl 2-[2-[4-[4-(triazol-1-yl)butyl]phenyl]ethylamino]acetate;tungsten;vanadium (CID 58653843) is methyl 2-[2-[4-[4-(triazol-1-yl)butyl]phenyl]ethylamino]acetate;tungsten;vanadium.
What is the SMILES notation for methyl 2-[2-[4-[4-(triazol-1-yl)butyl]phenyl]ethylamino]acetate;tungsten;vanadium?
The canonical SMILES for methyl 2-[2-[4-[4-(triazol-1-yl)butyl]phenyl]ethylamino]acetate;tungsten;vanadium is COC(=O)[CH-]N[CH-]Cc1ccc(CCCCn2ccnn2)cc1.[V].[W].
What is the InChIKey of methyl 2-[2-[4-[4-(triazol-1-yl)butyl]phenyl]ethylamino]acetate;tungsten;vanadium?
The InChIKey is HHOLHEHTZGZPDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O2.V.W/c1-23-17(22)14-18-10-9-16-7-5-15(6-8-16)4-2-3-12-21-13-11-19-20-21;;/h5-8,10-11,13-14,18H,2-4,9,12H2,1H3;;/q-2;;.
What are the key properties of methyl 2-[2-[4-[4-(triazol-1-yl)butyl]phenyl]ethylamino]acetate;tungsten;vanadium?
methyl 2-[2-[4-[4-(triazol-1-yl)butyl]phenyl]ethylamino]acetate;tungsten;vanadium has a molecular weight of 549.17 g/mol, XLogP of 1.92, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-[4-[4-(triazol-1-yl)butyl]phenyl]ethylamino]acetate;tungsten;vanadium is sourced from PubChem (CID 58653843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).