C22H18ClN5O2 — CID 58654024
3-chloro-N-[[4-cyano-2-[[2-oxo-2-(pyridin-2-ylamino)ethyl]amino]phenyl]methyl]benzamide (PubChem CID 58654024) has the molecular formula C22H18ClN5O2 and a molecular weight of 419.87 g/mol. Its IUPAC name is 3-chloro-N-[[4-cyano-2-[[2-oxo-2-(pyridin-2-ylamino)ethyl]amino]phenyl]methyl]benzamide.
| Compound Name | 3-chloro-N-[[4-cyano-2-[[2-oxo-2-(pyridin-2-ylamino)ethyl]amino]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 58654024 |
| Molecular Formula | C22H18ClN5O2 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 3-chloro-N-[[4-cyano-2-[[2-oxo-2-(pyridin-2-ylamino)ethyl]amino]phenyl]methyl]benzamide |
| SMILES | N#Cc1ccc(CNC(=O)c2cccc(Cl)c2)c(NCC(=O)Nc2ccccn2)c1 |
| InChI | InChI=1S/C22H18ClN5O2/c23-18-5-3-4-16(11-18)22(30)27-13-17-8-7-15(12-24)10-19(17)26-14-21(29)28-20-6-1-2-9-25-20/h1-11,26H,13-14H2,(H,27,30)(H,25,28,29) |
| InChIKey | HMEDGFVCRUBQMY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |