C24H37F2NO5 — CID 58654659
7-[(1R,2R,5S)-2-[(3R)-5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid (PubChem CID 58654659) has the molecular formula C24H37F2NO5 and a molecular weight of 457.56 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-2-[(3R)-5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,5S)-2-[(3R)-5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 58654659 |
| Molecular Formula | C24H37F2NO5 |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 7-[(1R,2R,5S)-2-[(3R)-5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid |
| SMILES | CONC1C[C@H](O)[C@H](CCCCCCC(=O)O)[C@H]1CC[C@@H](O)CCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C24H37F2NO5/c1-32-27-22-15-23(29)21(6-4-2-3-5-7-24(30)31)20(22)11-10-19(28)9-8-16-12-17(25)14-18(26)13-16/h12-14,19-23,27-29H,2-11,15H2,1H3,(H,30,31)/t19-,20+,21+,22?,23-/m0/s1 |
| InChIKey | DHWYEERYRDVJTH-QLYHNFIXSA-N |
| XLogP | 3.98 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|