C26H39FN2O4 — CID 58654678
methyl (Z)-7-[(1R,2R,5S)-2-[(E)-5-(2-fluorophenyl)-3-methyl-3-(methylamino)pent-1-enyl]-5-hydroxy-3-(hydroxyamino)cyclopentyl]hept-5-enoate (PubChem CID 58654678) has the molecular formula C26H39FN2O4 and a molecular weight of 462.61 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,5S)-2-[(E)-5-(2-fluorophenyl)-3-methyl-3-(methylamino)pent-1-enyl]-5-hydroxy-3-(hydroxyamino)cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,5S)-2-[(E)-5-(2-fluorophenyl)-3-methyl-3-(methylamino)pent-1-enyl]-5-hydroxy-3-(hydroxyamino)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 58654678 |
| Molecular Formula | C26H39FN2O4 |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,5S)-2-[(E)-5-(2-fluorophenyl)-3-methyl-3-(methylamino)pent-1-enyl]-5-hydroxy-3-(hydroxyamino)cyclopentyl]hept-5-enoate |
| SMILES | CNC(C)(/C=C/[C@H]1C(NO)C[C@H](O)[C@@H]1C/C=C\CCCC(=O)OC)CCc1ccccc1F |
| InChI | InChI=1S/C26H39FN2O4/c1-26(28-2,16-14-19-10-8-9-12-22(19)27)17-15-20-21(24(30)18-23(20)29-32)11-6-4-5-7-13-25(31)33-3/h4,6,8-10,12,15,17,20-21,23-24,28-30,32H,5,7,11,13-14,16,18H2,1-3H3/b6-4-,17-15+/t20-,21-,23?,24+,26?/m1/s1 |
| InChIKey | BFYZWTLVZRGHQN-MJYDPIMJSA-N |
| XLogP | 3.93 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|