C9H12O4 — CID 58654717
(3aR,5R)-5-methoxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-carbaldehyde (PubChem CID 58654717) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is (3aR,5R)-5-methoxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-carbaldehyde.
| Compound Name | (3aR,5R)-5-methoxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-carbaldehyde |
|---|---|
| PubChem CID | 58654717 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (3aR,5R)-5-methoxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-carbaldehyde |
| SMILES | CO[C@@H]1CC2OC(=O)C[C@@H]2C1C=O |
| InChI | InChI=1S/C9H12O4/c1-12-7-3-8-5(6(7)4-10)2-9(11)13-8/h4-8H,2-3H2,1H3/t5-,6?,7-,8?/m1/s1 |
| InChIKey | MOQAIGQKUKIVAB-RYVOCIFZSA-N |
| XLogP | 0.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|