About [2-hydroxy-3-[2-(2-methoxyethoxy)ethylamino]propyl] 2,2-dimethylhexanoate
[2-hydroxy-3-[2-(2-methoxyethoxy)ethylamino]propyl] 2,2-dimethylhexanoate (PubChem CID 58654743) has the molecular formula C16H33NO5
and a molecular weight of 319.44 g/mol. Its IUPAC name is [2-hydroxy-3-[2-(2-methoxyethoxy)ethylamino]propyl] 2,2-dimethylhexanoate.
Molecular Properties
| Compound Name | [2-hydroxy-3-[2-(2-methoxyethoxy)ethylamino]propyl] 2,2-dimethylhexanoate |
| PubChem CID | 58654743 |
| Molecular Formula | C16H33NO5 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | [2-hydroxy-3-[2-(2-methoxyethoxy)ethylamino]propyl] 2,2-dimethylhexanoate |
| SMILES | CCCCC(C)(C)C(=O)OCC(O)CNCCOCCOC |
| InChI | InChI=1S/C16H33NO5/c1-5-6-7-16(2,3)15(19)22-13-14(18)12-17-8-9-21-11-10-20-4/h14,17-18H,5-13H2,1-4H3 |
| InChIKey | UYIYWYBSWUGIHQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-hydroxy-3-[2-(2-methoxyethoxy)ethylamino]propyl] 2,2-dimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-hydroxy-3-[2-(2-methoxyethoxy)ethylamino]propyl] 2,2-dimethylhexanoate?
The IUPAC name of [2-hydroxy-3-[2-(2-methoxyethoxy)ethylamino]propyl] 2,2-dimethylhexanoate (CID 58654743) is [2-hydroxy-3-[2-(2-methoxyethoxy)ethylamino]propyl] 2,2-dimethylhexanoate.
What is the SMILES notation for [2-hydroxy-3-[2-(2-methoxyethoxy)ethylamino]propyl] 2,2-dimethylhexanoate?
The canonical SMILES for [2-hydroxy-3-[2-(2-methoxyethoxy)ethylamino]propyl] 2,2-dimethylhexanoate is CCCCC(C)(C)C(=O)OCC(O)CNCCOCCOC.
What is the InChIKey of [2-hydroxy-3-[2-(2-methoxyethoxy)ethylamino]propyl] 2,2-dimethylhexanoate?
The InChIKey is UYIYWYBSWUGIHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO5/c1-5-6-7-16(2,3)15(19)22-13-14(18)12-17-8-9-21-11-10-20-4/h14,17-18H,5-13H2,1-4H3.
What are the key properties of [2-hydroxy-3-[2-(2-methoxyethoxy)ethylamino]propyl] 2,2-dimethylhexanoate?
[2-hydroxy-3-[2-(2-methoxyethoxy)ethylamino]propyl] 2,2-dimethylhexanoate has a molecular weight of 319.44 g/mol, XLogP of 1.36, 14 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-hydroxy-3-[2-(2-methoxyethoxy)ethylamino]propyl] 2,2-dimethylhexanoate is sourced from PubChem (CID 58654743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).