C31H40O4SSi — CID 58654852
[(3S,4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-5-methyl-6-methylsulfanyl-3-phenylmethoxyoxan-2-yl]methanol (PubChem CID 58654852) has the molecular formula C31H40O4SSi and a molecular weight of 536.81 g/mol. Its IUPAC name is [(3S,4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-5-methyl-6-methylsulfanyl-3-phenylmethoxyoxan-2-yl]methanol.
| Compound Name | [(3S,4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-5-methyl-6-methylsulfanyl-3-phenylmethoxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 58654852 |
| Molecular Formula | C31H40O4SSi |
| Molecular Weight | 536.81 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | [(3S,4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-5-methyl-6-methylsulfanyl-3-phenylmethoxyoxan-2-yl]methanol |
| SMILES | CS[C@@H]1OC(CO)[C@H](OCc2ccccc2)[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1C |
| InChI | InChI=1S/C31H40O4SSi/c1-23-28(29(27(21-32)34-30(23)36-5)33-22-24-15-9-6-10-16-24)35-37(31(2,3)4,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,23,27-30,32H,21-22H2,1-5H3/t23?,27?,28-,29+,30+/m1/s1 |
| InChIKey | MUTYRIKYYXCYGC-GLSZONSPSA-N |
| XLogP | 5.23 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.81 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|