C30H40N3O4S2- — CID 58655565
4-[[4-[4-[(4-heptan-4-yl-N-methylanilino)methyl]phenyl]-1,3-thiazol-2-yl]methyl-methylsulfamoyl]butanoate (PubChem CID 58655565) has the molecular formula C30H40N3O4S2- and a molecular weight of 570.80 g/mol. Its IUPAC name is 4-[[4-[4-[(4-heptan-4-yl-N-methylanilino)methyl]phenyl]-1,3-thiazol-2-yl]methyl-methylsulfamoyl]butanoate.
| Compound Name | 4-[[4-[4-[(4-heptan-4-yl-N-methylanilino)methyl]phenyl]-1,3-thiazol-2-yl]methyl-methylsulfamoyl]butanoate |
|---|---|
| PubChem CID | 58655565 |
| Molecular Formula | C30H40N3O4S2- |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 4-[[4-[4-[(4-heptan-4-yl-N-methylanilino)methyl]phenyl]-1,3-thiazol-2-yl]methyl-methylsulfamoyl]butanoate |
| SMILES | CCCC(CCC)c1ccc(N(C)Cc2ccc(-c3csc(CN(C)S(=O)(=O)CCCC(=O)[O-])n3)cc2)cc1 |
| InChI | InChI=1S/C30H41N3O4S2/c1-5-8-24(9-6-2)25-15-17-27(18-16-25)32(3)20-23-11-13-26(14-12-23)28-22-38-29(31-28)21-33(4)39(36,37)19-7-10-30(34)35/h11-18,22,24H,5-10,19-21H2,1-4H3,(H,34,35)/p-1 |
| InChIKey | FCPIJCONXNUDGS-UHFFFAOYSA-M |
| XLogP | 5.42 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|