About 2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile
2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile (PubChem CID 58655889) has the molecular formula C6H3N5
and a molecular weight of 145.12 g/mol. Its IUPAC name is 2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile.
Molecular Properties
| Compound Name | 2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile |
| PubChem CID | 58655889 |
| Molecular Formula | C6H3N5 |
| Molecular Weight | 145.12 g/mol |
| Exact Mass | 145.04 |
| IUPAC Name | 2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile |
| SMILES | N#Cc1[nH]nc2ncncc12 |
| InChI | InChI=1S/C6H3N5/c7-1-5-4-2-8-3-9-6(4)11-10-5/h2-3H,(H,8,9,10,11) |
| InChIKey | IVUZZGZAKBPNAE-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.12 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile?
The IUPAC name of 2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile (CID 58655889) is 2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile.
What is the SMILES notation for 2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile?
The canonical SMILES for 2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile is N#Cc1[nH]nc2ncncc12.
What is the InChIKey of 2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile?
The InChIKey is IVUZZGZAKBPNAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N5/c7-1-5-4-2-8-3-9-6(4)11-10-5/h2-3H,(H,8,9,10,11).
What are the key properties of 2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile?
2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile has a molecular weight of 145.12 g/mol, XLogP of 0.22, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile is sourced from PubChem (CID 58655889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).