About 3,3,3-trifluoro-N,N-di(propan-2-yl)prop-1-en-2-amine
3,3,3-trifluoro-N,N-di(propan-2-yl)prop-1-en-2-amine (PubChem CID 586561) has the molecular formula C9H16F3N
and a molecular weight of 195.23 g/mol. Its IUPAC name is 3,3,3-trifluoro-N,N-di(propan-2-yl)prop-1-en-2-amine.
Analyze 3,3,3-trifluoro-N,N-di(propan-2-yl)prop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3,3-trifluoro-N,N-di(propan-2-yl)prop-1-en-2-amine?
The IUPAC name of 3,3,3-trifluoro-N,N-di(propan-2-yl)prop-1-en-2-amine (CID 586561) is 3,3,3-trifluoro-N,N-di(propan-2-yl)prop-1-en-2-amine.
What is the SMILES notation for 3,3,3-trifluoro-N,N-di(propan-2-yl)prop-1-en-2-amine?
The canonical SMILES for 3,3,3-trifluoro-N,N-di(propan-2-yl)prop-1-en-2-amine is C=C(N(C(C)C)C(C)C)C(F)(F)F.
What is the InChIKey of 3,3,3-trifluoro-N,N-di(propan-2-yl)prop-1-en-2-amine?
The InChIKey is LWHRYFZHXWCGPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3N/c1-6(2)13(7(3)4)8(5)9(10,11)12/h6-7H,5H2,1-4H3.
What are the key properties of 3,3,3-trifluoro-N,N-di(propan-2-yl)prop-1-en-2-amine?
3,3,3-trifluoro-N,N-di(propan-2-yl)prop-1-en-2-amine has a molecular weight of 195.23 g/mol, XLogP of 3.18, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,3-trifluoro-N,N-di(propan-2-yl)prop-1-en-2-amine is sourced from PubChem (CID 586561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).