C22H23Cl2FN2O3 — CID 58656605
ethyl 4-(2,4-dichloro-5-fluorobenzoyl)-2-ethyl-6,7-dimethyl-2,3-dihydroquinoxaline-1-carboxylate (PubChem CID 58656605) has the molecular formula C22H23Cl2FN2O3 and a molecular weight of 453.34 g/mol. Its IUPAC name is ethyl 4-(2,4-dichloro-5-fluorobenzoyl)-2-ethyl-6,7-dimethyl-2,3-dihydroquinoxaline-1-carboxylate.
| Compound Name | ethyl 4-(2,4-dichloro-5-fluorobenzoyl)-2-ethyl-6,7-dimethyl-2,3-dihydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 58656605 |
| Molecular Formula | C22H23Cl2FN2O3 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | ethyl 4-(2,4-dichloro-5-fluorobenzoyl)-2-ethyl-6,7-dimethyl-2,3-dihydroquinoxaline-1-carboxylate |
| SMILES | CCOC(=O)N1c2cc(C)c(C)cc2N(C(=O)c2cc(F)c(Cl)cc2Cl)CC1CC |
| InChI | InChI=1S/C22H23Cl2FN2O3/c1-5-14-11-26(21(28)15-9-18(25)17(24)10-16(15)23)19-7-12(3)13(4)8-20(19)27(14)22(29)30-6-2/h7-10,14H,5-6,11H2,1-4H3 |
| InChIKey | ZSINWDHJVATJNG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|