About 5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-2-yloxy)thiophene-2-carboxamide
5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-2-yloxy)thiophene-2-carboxamide (PubChem CID 58657169) has the molecular formula C13H15N3O4S
and a molecular weight of 309.35 g/mol. Its IUPAC name is 5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-2-yloxy)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-2-yloxy)thiophene-2-carboxamide |
| PubChem CID | 58657169 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-2-yloxy)thiophene-2-carboxamide |
| SMILES | Cc1noc(-c2ccc(C(=O)NOC3CCCCO3)s2)n1 |
| InChI | InChI=1S/C13H15N3O4S/c1-8-14-13(20-15-8)10-6-5-9(21-10)12(17)16-19-11-4-2-3-7-18-11/h5-6,11H,2-4,7H2,1H3,(H,16,17) |
| InChIKey | AXPQDRGKYSMYKE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-2-yloxy)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-2-yloxy)thiophene-2-carboxamide?
The IUPAC name of 5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-2-yloxy)thiophene-2-carboxamide (CID 58657169) is 5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-2-yloxy)thiophene-2-carboxamide.
What is the SMILES notation for 5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-2-yloxy)thiophene-2-carboxamide?
The canonical SMILES for 5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-2-yloxy)thiophene-2-carboxamide is Cc1noc(-c2ccc(C(=O)NOC3CCCCO3)s2)n1.
What is the InChIKey of 5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-2-yloxy)thiophene-2-carboxamide?
The InChIKey is AXPQDRGKYSMYKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O4S/c1-8-14-13(20-15-8)10-6-5-9(21-10)12(17)16-19-11-4-2-3-7-18-11/h5-6,11H,2-4,7H2,1H3,(H,16,17).
What are the key properties of 5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-2-yloxy)thiophene-2-carboxamide?
5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-2-yloxy)thiophene-2-carboxamide has a molecular weight of 309.35 g/mol, XLogP of 2.29, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-2-yloxy)thiophene-2-carboxamide is sourced from PubChem (CID 58657169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).