C29H38F3NO6S — CID 58657366
7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-3-(trifluoromethyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 58657366) has the molecular formula C29H38F3NO6S and a molecular weight of 585.69 g/mol. Its IUPAC name is 7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-3-(trifluoromethyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-3-(trifluoromethyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 58657366 |
| Molecular Formula | C29H38F3NO6S |
| Molecular Weight | 585.69 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | 7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-3-(trifluoromethyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | Cc1nc2cc(C3(C(F)(F)F)CC4OC4(C)CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O3)ccc2s1 |
| InChI | InChI=1S/C29H38F3NO6S/c1-15-8-7-11-27(6)22(38-27)14-28(29(30,31)32,18-9-10-20-19(12-18)33-17(3)40-20)39-23(35)13-21(34)26(4,5)25(37)16(2)24(15)36/h9-10,12,15-16,21-22,24,34,36H,7-8,11,13-14H2,1-6H3 |
| InChIKey | OUVHJDZRLKLYSS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.69 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|