C29H38F3NO5S — CID 58657368
(13Z)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-16-(trifluoromethyl)-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 58657368) has the molecular formula C29H38F3NO5S and a molecular weight of 569.69 g/mol. Its IUPAC name is (13Z)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-16-(trifluoromethyl)-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (13Z)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-16-(trifluoromethyl)-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 58657368 |
| Molecular Formula | C29H38F3NO5S |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | (13Z)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-16-(trifluoromethyl)-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/CC(c2ccc3sc(C)nc3c2)(C(F)(F)F)OC(=O)CC(O)C(C)(C)C(=O)C(C)C(O)C(C)CCC1 |
| InChI | InChI=1S/C29H38F3NO5S/c1-16-8-7-9-17(2)25(36)18(3)26(37)27(5,6)23(34)15-24(35)38-28(13-12-16,29(30,31)32)20-10-11-22-21(14-20)33-19(4)39-22/h10-12,14,17-18,23,25,34,36H,7-9,13,15H2,1-6H3/b16-12- |
| InChIKey | FRTYYVNBGLDLEX-VBKFSLOCSA-N |
| XLogP | 6.41 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|