About cobalt;1-ethylindazole
cobalt;1-ethylindazole (PubChem CID 58657391) has the molecular formula C9H9CoN2-
and a molecular weight of 204.12 g/mol. Its IUPAC name is cobalt;1-ethylindazole.
Molecular Properties
| Compound Name | cobalt;1-ethylindazole |
| PubChem CID | 58657391 |
| Molecular Formula | C9H9CoN2- |
| Molecular Weight | 204.12 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | cobalt;1-ethylindazole |
| SMILES | [CH2-]Cn1ncc2ccccc21.[Co] |
| InChI | InChI=1S/C9H9N2.Co/c1-2-11-9-6-4-3-5-8(9)7-10-11;/h3-7H,1-2H2;/q-1; |
| InChIKey | XKFVNCRMYUCSBB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.12 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cobalt;1-ethylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;1-ethylindazole?
The IUPAC name of cobalt;1-ethylindazole (CID 58657391) is cobalt;1-ethylindazole.
What is the SMILES notation for cobalt;1-ethylindazole?
The canonical SMILES for cobalt;1-ethylindazole is [CH2-]Cn1ncc2ccccc21.[Co].
What is the InChIKey of cobalt;1-ethylindazole?
The InChIKey is XKFVNCRMYUCSBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N2.Co/c1-2-11-9-6-4-3-5-8(9)7-10-11;/h3-7H,1-2H2;/q-1;.
What are the key properties of cobalt;1-ethylindazole?
cobalt;1-ethylindazole has a molecular weight of 204.12 g/mol, XLogP of 1.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;1-ethylindazole is sourced from PubChem (CID 58657391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).