C51H46O4 — CID 58658020
[1,1,1',1'-tetramethyl-5'-[[4-[(E)-2-phenylethenyl]phenyl]methylperoxy]-3,3'-spirobi[2H-indene]-5-yl] 4-[(E)-2-phenylethenyl]benzoate (PubChem CID 58658020) has the molecular formula C51H46O4 and a molecular weight of 722.93 g/mol. Its IUPAC name is [1,1,1',1'-tetramethyl-5'-[[4-[(E)-2-phenylethenyl]phenyl]methylperoxy]-3,3'-spirobi[2H-indene]-5-yl] 4-[(E)-2-phenylethenyl]benzoate.
| Compound Name | [1,1,1',1'-tetramethyl-5'-[[4-[(E)-2-phenylethenyl]phenyl]methylperoxy]-3,3'-spirobi[2H-indene]-5-yl] 4-[(E)-2-phenylethenyl]benzoate |
|---|---|
| PubChem CID | 58658020 |
| Molecular Formula | C51H46O4 |
| Molecular Weight | 722.93 g/mol |
| Exact Mass | 722.34 |
| IUPAC Name | [1,1,1',1'-tetramethyl-5'-[[4-[(E)-2-phenylethenyl]phenyl]methylperoxy]-3,3'-spirobi[2H-indene]-5-yl] 4-[(E)-2-phenylethenyl]benzoate |
| SMILES | CC1(C)CC2(CC(C)(C)c3ccc(OC(=O)c4ccc(/C=C/c5ccccc5)cc4)cc32)c2cc(OOCc3ccc(/C=C/c4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C51H46O4/c1-49(2)34-51(46-31-42(27-29-44(46)49)54-48(52)41-25-23-39(24-26-41)18-16-37-13-9-6-10-14-37)35-50(3,4)45-30-28-43(32-47(45)51)55-53-33-40-21-19-38(20-22-40)17-15-36-11-7-5-8-12-36/h5-32H,33-35H2,1-4H3/b17-15+,18-16+ |
| InChIKey | YBLJODLWFXWGTA-YTEMWHBBSA-N |
| XLogP | 12.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.93 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|