C43H28F6N2O7S2 — CID 58658207
2-[4-[2-[4-[2-cyano-3-[4-methyl-3-[3-(trioxidanylsulfanyl)phenyl]sulfonylphenyl]phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-6-methylbenzonitrile (PubChem CID 58658207) has the molecular formula C43H28F6N2O7S2 and a molecular weight of 862.83 g/mol. Its IUPAC name is 2-[4-[2-[4-[2-cyano-3-[4-methyl-3-[3-(trioxidanylsulfanyl)phenyl]sulfonylphenyl]phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-6-methylbenzonitrile.
| Compound Name | 2-[4-[2-[4-[2-cyano-3-[4-methyl-3-[3-(trioxidanylsulfanyl)phenyl]sulfonylphenyl]phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-6-methylbenzonitrile |
|---|---|
| PubChem CID | 58658207 |
| Molecular Formula | C43H28F6N2O7S2 |
| Molecular Weight | 862.83 g/mol |
| Exact Mass | 862.12 |
| IUPAC Name | 2-[4-[2-[4-[2-cyano-3-[4-methyl-3-[3-(trioxidanylsulfanyl)phenyl]sulfonylphenyl]phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-6-methylbenzonitrile |
| SMILES | Cc1ccc(-c2cccc(Oc3ccc(C(c4ccc(Oc5cccc(C)c5C#N)cc4)(C(F)(F)F)C(F)(F)F)cc3)c2C#N)cc1S(=O)(=O)c1cccc(SOOO)c1 |
| InChI | InChI=1S/C43H28F6N2O7S2/c1-26-6-3-10-38(36(26)24-50)55-31-18-14-29(15-19-31)41(42(44,45)46,43(47,48)49)30-16-20-32(21-17-30)56-39-11-5-9-35(37(39)25-51)28-13-12-27(2)40(22-28)60(53,54)34-8-4-7-33(23-34)59-58-57-52/h3-23,52H,1-2H3 |
| InChIKey | WYONUDNHNGHGOF-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.83 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|