C15H28O2 — CID 58658291
(4S,6R)-2-ethyl-3,4,5-trimethyl-6-pent-4-enoxyoxane (PubChem CID 58658291) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (4S,6R)-2-ethyl-3,4,5-trimethyl-6-pent-4-enoxyoxane.
| Compound Name | (4S,6R)-2-ethyl-3,4,5-trimethyl-6-pent-4-enoxyoxane |
|---|---|
| PubChem CID | 58658291 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (4S,6R)-2-ethyl-3,4,5-trimethyl-6-pent-4-enoxyoxane |
| SMILES | C=CCCCO[C@@H]1OC(CC)C(C)[C@H](C)C1C |
| InChI | InChI=1S/C15H28O2/c1-6-8-9-10-16-15-13(5)11(3)12(4)14(7-2)17-15/h6,11-15H,1,7-10H2,2-5H3/t11-,12?,13?,14?,15+/m0/s1 |
| InChIKey | CFUMBYPIULPTTR-WXVWGLJDSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|