C20H28N2O6Si — CID 58658821
(6aS)-2,3-dimethoxy-5-(2-trimethylsilylethoxymethyl)-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepine-6,8,11-trione (PubChem CID 58658821) has the molecular formula C20H28N2O6Si and a molecular weight of 420.54 g/mol. Its IUPAC name is (6aS)-2,3-dimethoxy-5-(2-trimethylsilylethoxymethyl)-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepine-6,8,11-trione.
| Compound Name | (6aS)-2,3-dimethoxy-5-(2-trimethylsilylethoxymethyl)-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepine-6,8,11-trione |
|---|---|
| PubChem CID | 58658821 |
| Molecular Formula | C20H28N2O6Si |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (6aS)-2,3-dimethoxy-5-(2-trimethylsilylethoxymethyl)-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepine-6,8,11-trione |
| SMILES | COc1cc2c(cc1OC)N(COCC[Si](C)(C)C)C(=O)[C@@H]1CC(=O)CN1C2=O |
| InChI | InChI=1S/C20H28N2O6Si/c1-26-17-9-14-15(10-18(17)27-2)22(12-28-6-7-29(3,4)5)20(25)16-8-13(23)11-21(16)19(14)24/h9-10,16H,6-8,11-12H2,1-5H3/t16-/m0/s1 |
| InChIKey | RQHUGMIFBXMEBG-INIZCTEOSA-N |
| XLogP | 2.15 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|