C20H30N2O5Si — CID 58658829
(6aS,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione (PubChem CID 58658829) has the molecular formula C20H30N2O5Si and a molecular weight of 406.56 g/mol. Its IUPAC name is (6aS,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione.
| Compound Name | (6aS,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
|---|---|
| PubChem CID | 58658829 |
| Molecular Formula | C20H30N2O5Si |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (6aS,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
| SMILES | COc1cc2c(cc1OC)C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C20H30N2O5Si/c1-20(2,3)28(6,7)27-12-8-15-18(23)21-14-10-17(26-5)16(25-4)9-13(14)19(24)22(15)11-12/h9-10,12,15H,8,11H2,1-7H3,(H,21,23)/t12-,15+/m1/s1 |
| InChIKey | BWJUSXPHKDHIQD-DOMZBBRYSA-N |
| XLogP | 3.26 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|