C26H33Cl2FN6O2 — CID 58659170
2-[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-methylpyrazol-1-yl]-N-[3-(dimethylamino)propyl]-2-methylpropanamide (PubChem CID 58659170) has the molecular formula C26H33Cl2FN6O2 and a molecular weight of 551.49 g/mol. Its IUPAC name is 2-[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-methylpyrazol-1-yl]-N-[3-(dimethylamino)propyl]-2-methylpropanamide.
| Compound Name | 2-[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-methylpyrazol-1-yl]-N-[3-(dimethylamino)propyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 58659170 |
| Molecular Formula | C26H33Cl2FN6O2 |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 2-[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-methylpyrazol-1-yl]-N-[3-(dimethylamino)propyl]-2-methylpropanamide |
| SMILES | Cc1nn(C(C)(C)C(=O)NCCCN(C)C)cc1-c1cnc(N)c(OC(C)c2c(Cl)ccc(F)c2Cl)c1 |
| InChI | InChI=1S/C26H33Cl2FN6O2/c1-15-18(14-35(33-15)26(3,4)25(36)31-10-7-11-34(5)6)17-12-21(24(30)32-13-17)37-16(2)22-19(27)8-9-20(29)23(22)28/h8-9,12-14,16H,7,10-11H2,1-6H3,(H2,30,32)(H,31,36) |
| InChIKey | YABCZZOVZOLVLI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|