C18H14O6S2 — CID 58659859
diethyl 2-(1,3-dioxoinden-2-ylidene)-1,3-dithiole-4,5-dicarboxylate (PubChem CID 58659859) has the molecular formula C18H14O6S2 and a molecular weight of 390.44 g/mol. Its IUPAC name is diethyl 2-(1,3-dioxoinden-2-ylidene)-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | diethyl 2-(1,3-dioxoinden-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 58659859 |
| Molecular Formula | C18H14O6S2 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | diethyl 2-(1,3-dioxoinden-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)SC(=C2C(=O)c3ccccc3C2=O)S1 |
| InChI | InChI=1S/C18H14O6S2/c1-3-23-16(21)14-15(17(22)24-4-2)26-18(25-14)11-12(19)9-7-5-6-8-10(9)13(11)20/h5-8H,3-4H2,1-2H3 |
| InChIKey | SIHMROORDLVIMR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|