C30H21NO4S2 — CID 58660295
2-[[5-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]methylidene]propanedioic acid (PubChem CID 58660295) has the molecular formula C30H21NO4S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is 2-[[5-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]methylidene]propanedioic acid.
| Compound Name | 2-[[5-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]methylidene]propanedioic acid |
|---|---|
| PubChem CID | 58660295 |
| Molecular Formula | C30H21NO4S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | 2-[[5-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]methylidene]propanedioic acid |
| SMILES | O=C(O)C(=Cc1ccc(-c2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)s2)s1)C(=O)O |
| InChI | InChI=1S/C30H21NO4S2/c32-29(33)25(30(34)35)19-24-15-16-27(36-24)28-18-17-26(37-28)20-11-13-23(14-12-20)31(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-19H,(H,32,33)(H,34,35) |
| InChIKey | IXDHEESJIPDPGS-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|