C12H13F3O — CID 58660370
3,4,4-trifluoro-2,3,7-trimethyl-2H-chromene (PubChem CID 58660370) has the molecular formula C12H13F3O and a molecular weight of 230.23 g/mol. Its IUPAC name is 3,4,4-trifluoro-2,3,7-trimethyl-2H-chromene.
| Compound Name | 3,4,4-trifluoro-2,3,7-trimethyl-2H-chromene |
|---|---|
| PubChem CID | 58660370 |
| Molecular Formula | C12H13F3O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3,4,4-trifluoro-2,3,7-trimethyl-2H-chromene |
| SMILES | Cc1ccc2c(c1)OC(C)C(C)(F)C2(F)F |
| InChI | InChI=1S/C12H13F3O/c1-7-4-5-9-10(6-7)16-8(2)11(3,13)12(9,14)15/h4-6,8H,1-3H3 |
| InChIKey | OOPMYPWORCALKV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |