About 7-(2,6-difluoro-4-pentylphenyl)-3-(trifluoromethyl)-3,4-dihydro-1H-isochromene
7-(2,6-difluoro-4-pentylphenyl)-3-(trifluoromethyl)-3,4-dihydro-1H-isochromene (PubChem CID 58660438) has the molecular formula C21H21F5O
and a molecular weight of 384.39 g/mol. Its IUPAC name is 7-(2,6-difluoro-4-pentylphenyl)-3-(trifluoromethyl)-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | 7-(2,6-difluoro-4-pentylphenyl)-3-(trifluoromethyl)-3,4-dihydro-1H-isochromene |
| PubChem CID | 58660438 |
| Molecular Formula | C21H21F5O |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 7-(2,6-difluoro-4-pentylphenyl)-3-(trifluoromethyl)-3,4-dihydro-1H-isochromene |
| SMILES | CCCCCc1cc(F)c(-c2ccc3c(c2)COC(C(F)(F)F)C3)c(F)c1 |
| InChI | InChI=1S/C21H21F5O/c1-2-3-4-5-13-8-17(22)20(18(23)9-13)15-7-6-14-11-19(21(24,25)26)27-12-16(14)10-15/h6-10,19H,2-5,11-12H2,1H3 |
| InChIKey | GWJRZDKPLFRESW-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(2,6-difluoro-4-pentylphenyl)-3-(trifluoromethyl)-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,6-difluoro-4-pentylphenyl)-3-(trifluoromethyl)-3,4-dihydro-1H-isochromene?
The IUPAC name of 7-(2,6-difluoro-4-pentylphenyl)-3-(trifluoromethyl)-3,4-dihydro-1H-isochromene (CID 58660438) is 7-(2,6-difluoro-4-pentylphenyl)-3-(trifluoromethyl)-3,4-dihydro-1H-isochromene.
What is the SMILES notation for 7-(2,6-difluoro-4-pentylphenyl)-3-(trifluoromethyl)-3,4-dihydro-1H-isochromene?
The canonical SMILES for 7-(2,6-difluoro-4-pentylphenyl)-3-(trifluoromethyl)-3,4-dihydro-1H-isochromene is CCCCCc1cc(F)c(-c2ccc3c(c2)COC(C(F)(F)F)C3)c(F)c1.
What is the InChIKey of 7-(2,6-difluoro-4-pentylphenyl)-3-(trifluoromethyl)-3,4-dihydro-1H-isochromene?
The InChIKey is GWJRZDKPLFRESW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F5O/c1-2-3-4-5-13-8-17(22)20(18(23)9-13)15-7-6-14-11-19(21(24,25)26)27-12-16(14)10-15/h6-10,19H,2-5,11-12H2,1H3.
What are the key properties of 7-(2,6-difluoro-4-pentylphenyl)-3-(trifluoromethyl)-3,4-dihydro-1H-isochromene?
7-(2,6-difluoro-4-pentylphenyl)-3-(trifluoromethyl)-3,4-dihydro-1H-isochromene has a molecular weight of 384.39 g/mol, XLogP of 6.37, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,6-difluoro-4-pentylphenyl)-3-(trifluoromethyl)-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 58660438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).