About 3-(difluoromethyl)-7-(2,6-difluoro-4-propylphenyl)-3,4-dihydro-1H-isochromene
3-(difluoromethyl)-7-(2,6-difluoro-4-propylphenyl)-3,4-dihydro-1H-isochromene (PubChem CID 58660445) has the molecular formula C19H18F4O
and a molecular weight of 338.34 g/mol. Its IUPAC name is 3-(difluoromethyl)-7-(2,6-difluoro-4-propylphenyl)-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-7-(2,6-difluoro-4-propylphenyl)-3,4-dihydro-1H-isochromene |
| PubChem CID | 58660445 |
| Molecular Formula | C19H18F4O |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 3-(difluoromethyl)-7-(2,6-difluoro-4-propylphenyl)-3,4-dihydro-1H-isochromene |
| SMILES | CCCc1cc(F)c(-c2ccc3c(c2)COC(C(F)F)C3)c(F)c1 |
| InChI | InChI=1S/C19H18F4O/c1-2-3-11-6-15(20)18(16(21)7-11)13-5-4-12-9-17(19(22)23)24-10-14(12)8-13/h4-8,17,19H,2-3,9-10H2,1H3 |
| InChIKey | LYBVOCYHNDQFGV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(difluoromethyl)-7-(2,6-difluoro-4-propylphenyl)-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-7-(2,6-difluoro-4-propylphenyl)-3,4-dihydro-1H-isochromene?
The IUPAC name of 3-(difluoromethyl)-7-(2,6-difluoro-4-propylphenyl)-3,4-dihydro-1H-isochromene (CID 58660445) is 3-(difluoromethyl)-7-(2,6-difluoro-4-propylphenyl)-3,4-dihydro-1H-isochromene.
What is the SMILES notation for 3-(difluoromethyl)-7-(2,6-difluoro-4-propylphenyl)-3,4-dihydro-1H-isochromene?
The canonical SMILES for 3-(difluoromethyl)-7-(2,6-difluoro-4-propylphenyl)-3,4-dihydro-1H-isochromene is CCCc1cc(F)c(-c2ccc3c(c2)COC(C(F)F)C3)c(F)c1.
What is the InChIKey of 3-(difluoromethyl)-7-(2,6-difluoro-4-propylphenyl)-3,4-dihydro-1H-isochromene?
The InChIKey is LYBVOCYHNDQFGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18F4O/c1-2-3-11-6-15(20)18(16(21)7-11)13-5-4-12-9-17(19(22)23)24-10-14(12)8-13/h4-8,17,19H,2-3,9-10H2,1H3.
What are the key properties of 3-(difluoromethyl)-7-(2,6-difluoro-4-propylphenyl)-3,4-dihydro-1H-isochromene?
3-(difluoromethyl)-7-(2,6-difluoro-4-propylphenyl)-3,4-dihydro-1H-isochromene has a molecular weight of 338.34 g/mol, XLogP of 5.29, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-7-(2,6-difluoro-4-propylphenyl)-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 58660445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).