C11H11F3O — CID 58660511
3,3,8-trifluoro-2,6-dimethyl-2,4-dihydrochromene (PubChem CID 58660511) has the molecular formula C11H11F3O and a molecular weight of 216.20 g/mol. Its IUPAC name is 3,3,8-trifluoro-2,6-dimethyl-2,4-dihydrochromene.
| Compound Name | 3,3,8-trifluoro-2,6-dimethyl-2,4-dihydrochromene |
|---|---|
| PubChem CID | 58660511 |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 3,3,8-trifluoro-2,6-dimethyl-2,4-dihydrochromene |
| SMILES | Cc1cc(F)c2c(c1)CC(F)(F)C(C)O2 |
| InChI | InChI=1S/C11H11F3O/c1-6-3-8-5-11(13,14)7(2)15-10(8)9(12)4-6/h3-4,7H,5H2,1-2H3 |
| InChIKey | HSAWWIMJSMWYAL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |