C16H23FO — CID 58660642
3-fluoro-2,2,3,4,4,5,7-heptamethylchromene (PubChem CID 58660642) has the molecular formula C16H23FO and a molecular weight of 250.36 g/mol. Its IUPAC name is 3-fluoro-2,2,3,4,4,5,7-heptamethylchromene.
| Compound Name | 3-fluoro-2,2,3,4,4,5,7-heptamethylchromene |
|---|---|
| PubChem CID | 58660642 |
| Molecular Formula | C16H23FO |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 3-fluoro-2,2,3,4,4,5,7-heptamethylchromene |
| SMILES | Cc1cc(C)c2c(c1)OC(C)(C)C(C)(F)C2(C)C |
| InChI | InChI=1S/C16H23FO/c1-10-8-11(2)13-12(9-10)18-15(5,6)16(7,17)14(13,3)4/h8-9H,1-7H3 |
| InChIKey | IVNCKXPBCMLAAN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |