C11H8F6O — CID 58660723
1,1,3,4,4,5-hexafluoro-3,7-dimethylisochromene (PubChem CID 58660723) has the molecular formula C11H8F6O and a molecular weight of 270.17 g/mol. Its IUPAC name is 1,1,3,4,4,5-hexafluoro-3,7-dimethylisochromene.
| Compound Name | 1,1,3,4,4,5-hexafluoro-3,7-dimethylisochromene |
|---|---|
| PubChem CID | 58660723 |
| Molecular Formula | C11H8F6O |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1,1,3,4,4,5-hexafluoro-3,7-dimethylisochromene |
| SMILES | Cc1cc(F)c2c(c1)C(F)(F)OC(C)(F)C2(F)F |
| InChI | InChI=1S/C11H8F6O/c1-5-3-6-8(7(12)4-5)10(14,15)9(2,13)18-11(6,16)17/h3-4H,1-2H3 |
| InChIKey | PUQLOKQEEWHECY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |