C23H18F4O2 — CID 58660730
7-(4-ethylphenyl)-5-fluoro-3-(3,4,5-trifluorophenyl)-1,4-dihydroisochromen-3-ol (PubChem CID 58660730) has the molecular formula C23H18F4O2 and a molecular weight of 402.39 g/mol. Its IUPAC name is 7-(4-ethylphenyl)-5-fluoro-3-(3,4,5-trifluorophenyl)-1,4-dihydroisochromen-3-ol.
| Compound Name | 7-(4-ethylphenyl)-5-fluoro-3-(3,4,5-trifluorophenyl)-1,4-dihydroisochromen-3-ol |
|---|---|
| PubChem CID | 58660730 |
| Molecular Formula | C23H18F4O2 |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 7-(4-ethylphenyl)-5-fluoro-3-(3,4,5-trifluorophenyl)-1,4-dihydroisochromen-3-ol |
| SMILES | CCc1ccc(-c2cc(F)c3c(c2)COC(O)(c2cc(F)c(F)c(F)c2)C3)cc1 |
| InChI | InChI=1S/C23H18F4O2/c1-2-13-3-5-14(6-4-13)15-7-16-12-29-23(28,11-18(16)19(24)8-15)17-9-20(25)22(27)21(26)10-17/h3-10,28H,2,11-12H2,1H3 |
| InChIKey | JPQROKZYKNBHKS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|