C13H17O4P — CID 58660754
ethyl 3-(3,5-dimethyl-2-phosphanyloxyphenyl)oxirane-2-carboxylate (PubChem CID 58660754) has the molecular formula C13H17O4P and a molecular weight of 268.25 g/mol. Its IUPAC name is ethyl 3-(3,5-dimethyl-2-phosphanyloxyphenyl)oxirane-2-carboxylate.
| Compound Name | ethyl 3-(3,5-dimethyl-2-phosphanyloxyphenyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 58660754 |
| Molecular Formula | C13H17O4P |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | ethyl 3-(3,5-dimethyl-2-phosphanyloxyphenyl)oxirane-2-carboxylate |
| SMILES | CCOC(=O)C1OC1c1cc(C)cc(C)c1OP |
| InChI | InChI=1S/C13H17O4P/c1-4-15-13(14)12-11(16-12)9-6-7(2)5-8(3)10(9)17-18/h5-6,11-12H,4,18H2,1-3H3 |
| InChIKey | NVPBMLQZLVPLIE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|