C21H19F7O — CID 58660799
6-(2,6-difluoro-4-pentylphenyl)-3,3-difluoro-2-(trifluoromethyl)-2,4-dihydrochromene (PubChem CID 58660799) has the molecular formula C21H19F7O and a molecular weight of 420.37 g/mol. Its IUPAC name is 6-(2,6-difluoro-4-pentylphenyl)-3,3-difluoro-2-(trifluoromethyl)-2,4-dihydrochromene.
| Compound Name | 6-(2,6-difluoro-4-pentylphenyl)-3,3-difluoro-2-(trifluoromethyl)-2,4-dihydrochromene |
|---|---|
| PubChem CID | 58660799 |
| Molecular Formula | C21H19F7O |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 6-(2,6-difluoro-4-pentylphenyl)-3,3-difluoro-2-(trifluoromethyl)-2,4-dihydrochromene |
| SMILES | CCCCCc1cc(F)c(-c2ccc3c(c2)CC(F)(F)C(C(F)(F)F)O3)c(F)c1 |
| InChI | InChI=1S/C21H19F7O/c1-2-3-4-5-12-8-15(22)18(16(23)9-12)13-6-7-17-14(10-13)11-20(24,25)19(29-17)21(26,27)28/h6-10,19H,2-5,11H2,1H3 |
| InChIKey | QGQGLRVMLJOTHQ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|