C36H12F6N2O4 — CID 58660869
7,18-bis(2,4,6-trifluorophenyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone (PubChem CID 58660869) has the molecular formula C36H12F6N2O4 and a molecular weight of 650.49 g/mol. Its IUPAC name is 7,18-bis(2,4,6-trifluorophenyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone.
| Compound Name | 7,18-bis(2,4,6-trifluorophenyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 58660869 |
| Molecular Formula | C36H12F6N2O4 |
| Molecular Weight | 650.49 g/mol |
| Exact Mass | 650.07 |
| IUPAC Name | 7,18-bis(2,4,6-trifluorophenyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
| SMILES | O=C1c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C(=O)N1c1c(F)cc(F)cc1F)c64)C(=O)N(c1c(F)cc(F)cc1F)C5=O |
| InChI | InChI=1S/C36H12F6N2O4/c37-13-9-23(39)31(24(40)10-13)43-33(45)19-5-1-15-16-2-6-21-30-22(36(48)44(35(21)47)32-25(41)11-14(38)12-26(32)42)8-4-18(28(16)30)17-3-7-20(34(43)46)29(19)27(15)17/h1-12H |
| InChIKey | RZUGSWOFFACUOJ-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.49 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|