C30H20EuF3N2O2+ — CID 58660883
europium;1,10-phenanthroline;[(Z)-4,4,4-trifluoro-3-hydroxy-1-phenanthren-3-ylbut-2-enylidene]oxidanium (PubChem CID 58660883) has the molecular formula C30H20EuF3N2O2+ and a molecular weight of 649.46 g/mol. Its IUPAC name is europium;1,10-phenanthroline;[(Z)-4,4,4-trifluoro-3-hydroxy-1-phenanthren-3-ylbut-2-enylidene]oxidanium.
| Compound Name | europium;1,10-phenanthroline;[(Z)-4,4,4-trifluoro-3-hydroxy-1-phenanthren-3-ylbut-2-enylidene]oxidanium |
|---|---|
| PubChem CID | 58660883 |
| Molecular Formula | C30H20EuF3N2O2+ |
| Molecular Weight | 649.46 g/mol |
| Exact Mass | 650.07 |
| IUPAC Name | europium;1,10-phenanthroline;[(Z)-4,4,4-trifluoro-3-hydroxy-1-phenanthren-3-ylbut-2-enylidene]oxidanium |
| SMILES | [Eu].[H]/[O+]=C(/C=C(\O)C(F)(F)F)c1ccc2ccc3ccccc3c2c1.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C18H11F3O2.C12H8N2.Eu/c19-18(20,21)17(23)10-16(22)13-8-7-12-6-5-11-3-1-2-4-14(11)15(12)9-13;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-10,23H;1-8H;/p+1/b17-10-;; |
| InChIKey | IFFLJOYRGXTGIB-IURREUHRSA-O |
| XLogP | 7.67 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.46 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|