C20H14EuF3N2O2S+ — CID 58660899
europium;1,10-phenanthroline;[(Z)-4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-enylidene]oxidanium (PubChem CID 58660899) has the molecular formula C20H14EuF3N2O2S+ and a molecular weight of 555.37 g/mol. Its IUPAC name is europium;1,10-phenanthroline;[(Z)-4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-enylidene]oxidanium.
| Compound Name | europium;1,10-phenanthroline;[(Z)-4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-enylidene]oxidanium |
|---|---|
| PubChem CID | 58660899 |
| Molecular Formula | C20H14EuF3N2O2S+ |
| Molecular Weight | 555.37 g/mol |
| Exact Mass | 555.99 |
| IUPAC Name | europium;1,10-phenanthroline;[(Z)-4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-enylidene]oxidanium |
| SMILES | [Eu].[H]/[O+]=C(/C=C(\O)C(F)(F)F)c1cccs1.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C8H5F3O2S.Eu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h1-8H;1-4,13H;/p+1/b;7-4-; |
| InChIKey | AYPJKQHFSAOCIE-XTXOHDESSA-O |
| XLogP | 5.43 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|