C25H38O4 — CID 58660912
(6E)-5-hydroxy-6-(1-hydroxy-2-methylpropylidene)-2,4,4-tris(3-methylbut-2-enyl)cyclohexane-1,3-dione (PubChem CID 58660912) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is (6E)-5-hydroxy-6-(1-hydroxy-2-methylpropylidene)-2,4,4-tris(3-methylbut-2-enyl)cyclohexane-1,3-dione.
| Compound Name | (6E)-5-hydroxy-6-(1-hydroxy-2-methylpropylidene)-2,4,4-tris(3-methylbut-2-enyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 58660912 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | (6E)-5-hydroxy-6-(1-hydroxy-2-methylpropylidene)-2,4,4-tris(3-methylbut-2-enyl)cyclohexane-1,3-dione |
| SMILES | CC(C)=CCC1C(=O)/C(=C(/O)C(C)C)C(O)C(CC=C(C)C)(CC=C(C)C)C1=O |
| InChI | InChI=1S/C25H38O4/c1-15(2)9-10-19-22(27)20(21(26)18(7)8)24(29)25(23(19)28,13-11-16(3)4)14-12-17(5)6/h9,11-12,18-19,24,26,29H,10,13-14H2,1-8H3/b21-20- |
| InChIKey | MBHKCAABDDDTPW-MRCUWXFGSA-N |
| XLogP | 5.64 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|