C28H22N4 — CID 58661508
1-pyridin-4-yl-N-[(15R,16R)-16-(pyridin-4-ylmethylideneamino)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methanimine (PubChem CID 58661508) has the molecular formula C28H22N4 and a molecular weight of 414.51 g/mol. Its IUPAC name is 1-pyridin-4-yl-N-[(15R,16R)-16-(pyridin-4-ylmethylideneamino)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methanimine.
| Compound Name | 1-pyridin-4-yl-N-[(15R,16R)-16-(pyridin-4-ylmethylideneamino)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methanimine |
|---|---|
| PubChem CID | 58661508 |
| Molecular Formula | C28H22N4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-pyridin-4-yl-N-[(15R,16R)-16-(pyridin-4-ylmethylideneamino)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methanimine |
| SMILES | C(=N/[C@@H]1C2c3ccccc3C(c3ccccc32)[C@H]1/N=C/c1ccncc1)\c1ccncc1 |
| InChI | InChI=1S/C28H22N4/c1-2-6-22-21(5-1)25-23-7-3-4-8-24(23)26(22)28(32-18-20-11-15-30-16-12-20)27(25)31-17-19-9-13-29-14-10-19/h1-18,25-28H/b31-17+,32-18+/t25?,26?,27-,28-/m1/s1 |
| InChIKey | SQMDCZJJGFWQBN-RVYBLWEOSA-N |
| XLogP | 5.04 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|