C12H20O2 — CID 58661612
(2S)-2-[(1R,2R)-5,5-dideuterio-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one (PubChem CID 58661612) has the molecular formula C12H20O2 and a molecular weight of 198.30 g/mol. Its IUPAC name is (2S)-2-[(1R,2R)-5,5-dideuterio-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one.
| Compound Name | (2S)-2-[(1R,2R)-5,5-dideuterio-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 58661612 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 198.30 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (2S)-2-[(1R,2R)-5,5-dideuterio-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one |
| SMILES | [2H]C([2H])=CC[C@@H](C)[C@@H](O)[C@H]1C(=O)CCC1C |
| InChI | InChI=1S/C12H20O2/c1-4-5-9(3)12(14)11-8(2)6-7-10(11)13/h4,8-9,11-12,14H,1,5-7H2,2-3H3/t8?,9-,11-,12-/m1/s1/i1D2 |
| InChIKey | OJHYIYJUFZCEKL-DGJZEASHSA-N |
| XLogP | 2.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|